C23H35FO3 — CID 118283673
1-(4-ethoxy-3-fluoro-2-methylphenyl)-4-(5-pentyloxan-2-yl)butan-1-one (PubChem CID 118283673) has the molecular formula C23H35FO3 and a molecular weight of 378.53 g/mol. Its IUPAC name is 1-(4-ethoxy-3-fluoro-2-methylphenyl)-4-(5-pentyloxan-2-yl)butan-1-one.
| Compound Name | 1-(4-ethoxy-3-fluoro-2-methylphenyl)-4-(5-pentyloxan-2-yl)butan-1-one |
|---|---|
| PubChem CID | 118283673 |
| Molecular Formula | C23H35FO3 |
| Molecular Weight | 378.53 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | 1-(4-ethoxy-3-fluoro-2-methylphenyl)-4-(5-pentyloxan-2-yl)butan-1-one |
| SMILES | CCCCCC1CCC(CCCC(=O)c2ccc(OCC)c(F)c2C)OC1 |
| InChI | InChI=1S/C23H35FO3/c1-4-6-7-9-18-12-13-19(27-16-18)10-8-11-21(25)20-14-15-22(26-5-2)23(24)17(20)3/h14-15,18-19H,4-13,16H2,1-3H3 |
| InChIKey | PFCQFCYFKSPOFW-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.53 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|