C25H37FO3 — CID 118283724
1-(4-ethoxy-3-fluoro-2-methylphenyl)-2-[5-(4-propylcyclohexyl)oxan-2-yl]ethanone (PubChem CID 118283724) has the molecular formula C25H37FO3 and a molecular weight of 404.57 g/mol. Its IUPAC name is 1-(4-ethoxy-3-fluoro-2-methylphenyl)-2-[5-(4-propylcyclohexyl)oxan-2-yl]ethanone.
| Compound Name | 1-(4-ethoxy-3-fluoro-2-methylphenyl)-2-[5-(4-propylcyclohexyl)oxan-2-yl]ethanone |
|---|---|
| PubChem CID | 118283724 |
| Molecular Formula | C25H37FO3 |
| Molecular Weight | 404.57 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | 1-(4-ethoxy-3-fluoro-2-methylphenyl)-2-[5-(4-propylcyclohexyl)oxan-2-yl]ethanone |
| SMILES | CCCC1CCC(C2CCC(CC(=O)c3ccc(OCC)c(F)c3C)OC2)CC1 |
| InChI | InChI=1S/C25H37FO3/c1-4-6-18-7-9-19(10-8-18)20-11-12-21(29-16-20)15-23(27)22-13-14-24(28-5-2)25(26)17(22)3/h13-14,18-21H,4-12,15-16H2,1-3H3 |
| InChIKey | WUOPLZZHKOXFJP-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.57 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |