C19H25F3O2 — CID 118287310
[2-(difluoromethyl)-4-ethoxy-3-fluorophenyl]-(4-propylcyclohexyl)methanone (PubChem CID 118287310) has the molecular formula C19H25F3O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is [2-(difluoromethyl)-4-ethoxy-3-fluorophenyl]-(4-propylcyclohexyl)methanone.
| Compound Name | [2-(difluoromethyl)-4-ethoxy-3-fluorophenyl]-(4-propylcyclohexyl)methanone |
|---|---|
| PubChem CID | 118287310 |
| Molecular Formula | C19H25F3O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | [2-(difluoromethyl)-4-ethoxy-3-fluorophenyl]-(4-propylcyclohexyl)methanone |
| SMILES | CCCC1CCC(C(=O)c2ccc(OCC)c(F)c2C(F)F)CC1 |
| InChI | InChI=1S/C19H25F3O2/c1-3-5-12-6-8-13(9-7-12)18(23)14-10-11-15(24-4-2)17(20)16(14)19(21)22/h10-13,19H,3-9H2,1-2H3 |
| InChIKey | DSQFQMRLNNTKPG-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |