C23H33F3O2 — CID 118287112
1-[2-(difluoromethyl)-4-ethoxy-3-(fluoromethyl)phenyl]-4-(4-propylcyclohexyl)butan-1-one (PubChem CID 118287112) has the molecular formula C23H33F3O2 and a molecular weight of 398.51 g/mol. Its IUPAC name is 1-[2-(difluoromethyl)-4-ethoxy-3-(fluoromethyl)phenyl]-4-(4-propylcyclohexyl)butan-1-one.
| Compound Name | 1-[2-(difluoromethyl)-4-ethoxy-3-(fluoromethyl)phenyl]-4-(4-propylcyclohexyl)butan-1-one |
|---|---|
| PubChem CID | 118287112 |
| Molecular Formula | C23H33F3O2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | 1-[2-(difluoromethyl)-4-ethoxy-3-(fluoromethyl)phenyl]-4-(4-propylcyclohexyl)butan-1-one |
| SMILES | CCCC1CCC(CCCC(=O)c2ccc(OCC)c(CF)c2C(F)F)CC1 |
| InChI | InChI=1S/C23H33F3O2/c1-3-6-16-9-11-17(12-10-16)7-5-8-20(27)18-13-14-21(28-4-2)19(15-24)22(18)23(25)26/h13-14,16-17,23H,3-12,15H2,1-2H3 |
| InChIKey | AUQGGMLZOHAMGP-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |