C25H35F3O2 — CID 118287325
[2-(difluoromethyl)-4-ethoxy-3-fluorophenyl]-[4-(4-propylcyclohexyl)cyclohexyl]methanone (PubChem CID 118287325) has the molecular formula C25H35F3O2 and a molecular weight of 424.55 g/mol. Its IUPAC name is [2-(difluoromethyl)-4-ethoxy-3-fluorophenyl]-[4-(4-propylcyclohexyl)cyclohexyl]methanone.
| Compound Name | [2-(difluoromethyl)-4-ethoxy-3-fluorophenyl]-[4-(4-propylcyclohexyl)cyclohexyl]methanone |
|---|---|
| PubChem CID | 118287325 |
| Molecular Formula | C25H35F3O2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | [2-(difluoromethyl)-4-ethoxy-3-fluorophenyl]-[4-(4-propylcyclohexyl)cyclohexyl]methanone |
| SMILES | CCCC1CCC(C2CCC(C(=O)c3ccc(OCC)c(F)c3C(F)F)CC2)CC1 |
| InChI | InChI=1S/C25H35F3O2/c1-3-5-16-6-8-17(9-7-16)18-10-12-19(13-11-18)24(29)20-14-15-21(30-4-2)23(26)22(20)25(27)28/h14-19,25H,3-13H2,1-2H3 |
| InChIKey | RZHLYARRNILRKT-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |