C22H31BrF2O3 — CID 122215549
(2S,4R,5R)-5-bromo-4-(4-ethoxy-2,3-difluorophenyl)-2-(4-propylcyclohexyl)oxan-4-ol (PubChem CID 122215549) has the molecular formula C22H31BrF2O3 and a molecular weight of 461.39 g/mol. Its IUPAC name is (2S,4R,5R)-5-bromo-4-(4-ethoxy-2,3-difluorophenyl)-2-(4-propylcyclohexyl)oxan-4-ol.
| Compound Name | (2S,4R,5R)-5-bromo-4-(4-ethoxy-2,3-difluorophenyl)-2-(4-propylcyclohexyl)oxan-4-ol |
|---|---|
| PubChem CID | 122215549 |
| Molecular Formula | C22H31BrF2O3 |
| Molecular Weight | 461.39 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | (2S,4R,5R)-5-bromo-4-(4-ethoxy-2,3-difluorophenyl)-2-(4-propylcyclohexyl)oxan-4-ol |
| SMILES | CCCC1CCC([C@@H]2C[C@@](O)(c3ccc(OCC)c(F)c3F)[C@H](Br)CO2)CC1 |
| InChI | InChI=1S/C22H31BrF2O3/c1-3-5-14-6-8-15(9-7-14)18-12-22(26,19(23)13-28-18)16-10-11-17(27-4-2)21(25)20(16)24/h10-11,14-15,18-19,26H,3-9,12-13H2,1-2H3/t14?,15?,18-,19+,22+/m0/s1 |
| InChIKey | VWVSLYZEPFHKCF-LMJIOSOOSA-N |
| XLogP | 5.71 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.39 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|