C25H36F2O2 — CID 151722101
1-(4-ethoxy-2,3-difluorophenyl)-4-[(E)-2-(4-propylcyclohexyl)ethenyl]cyclohexan-1-ol (PubChem CID 151722101) has the molecular formula C25H36F2O2 and a molecular weight of 406.56 g/mol. Its IUPAC name is 1-(4-ethoxy-2,3-difluorophenyl)-4-[(E)-2-(4-propylcyclohexyl)ethenyl]cyclohexan-1-ol.
| Compound Name | 1-(4-ethoxy-2,3-difluorophenyl)-4-[(E)-2-(4-propylcyclohexyl)ethenyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 151722101 |
| Molecular Formula | C25H36F2O2 |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | 1-(4-ethoxy-2,3-difluorophenyl)-4-[(E)-2-(4-propylcyclohexyl)ethenyl]cyclohexan-1-ol |
| SMILES | CCCC1CCC(/C=C/C2CCC(O)(c3ccc(OCC)c(F)c3F)CC2)CC1 |
| InChI | InChI=1S/C25H36F2O2/c1-3-5-18-6-8-19(9-7-18)10-11-20-14-16-25(28,17-15-20)21-12-13-22(29-4-2)24(27)23(21)26/h10-13,18-20,28H,3-9,14-17H2,1-2H3/b11-10+ |
| InChIKey | RIUMVPWAUAPVJO-ZHACJKMWSA-N |
| XLogP | 6.90 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|