C28H40F4O2 — CID 59049009
1-[1,1-difluoro-3-[4-[(E)-2-(4-propylcyclohexyl)ethenyl]cyclohexyl]propoxy]-4-ethoxy-2,3-difluorobenzene (PubChem CID 59049009) has the molecular formula C28H40F4O2 and a molecular weight of 484.62 g/mol. Its IUPAC name is 1-[1,1-difluoro-3-[4-[(E)-2-(4-propylcyclohexyl)ethenyl]cyclohexyl]propoxy]-4-ethoxy-2,3-difluorobenzene.
| Compound Name | 1-[1,1-difluoro-3-[4-[(E)-2-(4-propylcyclohexyl)ethenyl]cyclohexyl]propoxy]-4-ethoxy-2,3-difluorobenzene |
|---|---|
| PubChem CID | 59049009 |
| Molecular Formula | C28H40F4O2 |
| Molecular Weight | 484.62 g/mol |
| Exact Mass | 484.30 |
| IUPAC Name | 1-[1,1-difluoro-3-[4-[(E)-2-(4-propylcyclohexyl)ethenyl]cyclohexyl]propoxy]-4-ethoxy-2,3-difluorobenzene |
| SMILES | CCCC1CCC(/C=C/C2CCC(CCC(F)(F)Oc3ccc(OCC)c(F)c3F)CC2)CC1 |
| InChI | InChI=1S/C28H40F4O2/c1-3-5-20-6-8-21(9-7-20)10-11-22-12-14-23(15-13-22)18-19-28(31,32)34-25-17-16-24(33-4-2)26(29)27(25)30/h10-11,16-17,20-23H,3-9,12-15,18-19H2,1-2H3/b11-10+ |
| InChIKey | HDPAPYXPYDFFLG-ZHACJKMWSA-N |
| XLogP | 9.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.62 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|