C29H42F4O3 — CID 123371801
1-butoxy-4-[1,1-difluoro-2-[4-[2-(4-propylcyclohexyl)ethenyl]cyclohexyl]oxyethoxy]-2,3-difluorobenzene (PubChem CID 123371801) has the molecular formula C29H42F4O3 and a molecular weight of 514.64 g/mol. Its IUPAC name is 1-butoxy-4-[1,1-difluoro-2-[4-[2-(4-propylcyclohexyl)ethenyl]cyclohexyl]oxyethoxy]-2,3-difluorobenzene.
| Compound Name | 1-butoxy-4-[1,1-difluoro-2-[4-[2-(4-propylcyclohexyl)ethenyl]cyclohexyl]oxyethoxy]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 123371801 |
| Molecular Formula | C29H42F4O3 |
| Molecular Weight | 514.64 g/mol |
| Exact Mass | 514.31 |
| IUPAC Name | 1-butoxy-4-[1,1-difluoro-2-[4-[2-(4-propylcyclohexyl)ethenyl]cyclohexyl]oxyethoxy]-2,3-difluorobenzene |
| SMILES | CCCCOc1ccc(OC(F)(F)COC2CCC(C=CC3CCC(CCC)CC3)CC2)c(F)c1F |
| InChI | InChI=1S/C29H42F4O3/c1-3-5-19-34-25-17-18-26(28(31)27(25)30)36-29(32,33)20-35-24-15-13-23(14-16-24)12-11-22-9-7-21(6-4-2)8-10-22/h11-12,17-18,21-24H,3-10,13-16,19-20H2,1-2H3 |
| InChIKey | KDJBIMWTZWWZEX-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.64 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|