C22H31BrF2O2 — CID 122215540
(2R,3S,5S)-3-bromo-5-(4-ethoxy-2,3-difluorophenyl)-2-(4-propylcyclohexyl)oxane (PubChem CID 122215540) has the molecular formula C22H31BrF2O2 and a molecular weight of 445.39 g/mol. Its IUPAC name is (2R,3S,5S)-3-bromo-5-(4-ethoxy-2,3-difluorophenyl)-2-(4-propylcyclohexyl)oxane.
| Compound Name | (2R,3S,5S)-3-bromo-5-(4-ethoxy-2,3-difluorophenyl)-2-(4-propylcyclohexyl)oxane |
|---|---|
| PubChem CID | 122215540 |
| Molecular Formula | C22H31BrF2O2 |
| Molecular Weight | 445.39 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | (2R,3S,5S)-3-bromo-5-(4-ethoxy-2,3-difluorophenyl)-2-(4-propylcyclohexyl)oxane |
| SMILES | CCCC1CCC([C@H]2OC[C@H](c3ccc(OCC)c(F)c3F)C[C@@H]2Br)CC1 |
| InChI | InChI=1S/C22H31BrF2O2/c1-3-5-14-6-8-15(9-7-14)22-18(23)12-16(13-27-22)17-10-11-19(26-4-2)21(25)20(17)24/h10-11,14-16,18,22H,3-9,12-13H2,1-2H3/t14?,15?,16-,18+,22-/m1/s1 |
| InChIKey | PPCAFNLHRZXRHB-MMYMENJVSA-N |
| XLogP | 6.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.39 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|