C28H42F2O4 — CID 67968478
5-(4-ethoxy-2,3-difluorophenyl)-2-[6-(4-pentylcyclohexyl)oxan-3-yl]-1,3-dioxane (PubChem CID 67968478) has the molecular formula C28H42F2O4 and a molecular weight of 480.64 g/mol. Its IUPAC name is 5-(4-ethoxy-2,3-difluorophenyl)-2-[6-(4-pentylcyclohexyl)oxan-3-yl]-1,3-dioxane.
| Compound Name | 5-(4-ethoxy-2,3-difluorophenyl)-2-[6-(4-pentylcyclohexyl)oxan-3-yl]-1,3-dioxane |
|---|---|
| PubChem CID | 67968478 |
| Molecular Formula | C28H42F2O4 |
| Molecular Weight | 480.64 g/mol |
| Exact Mass | 480.31 |
| IUPAC Name | 5-(4-ethoxy-2,3-difluorophenyl)-2-[6-(4-pentylcyclohexyl)oxan-3-yl]-1,3-dioxane |
| SMILES | CCCCCC1CCC(C2CCC(C3OCC(c4ccc(OCC)c(F)c4F)CO3)CO2)CC1 |
| InChI | InChI=1S/C28H42F2O4/c1-3-5-6-7-19-8-10-20(11-9-19)24-14-12-21(16-32-24)28-33-17-22(18-34-28)23-13-15-25(31-4-2)27(30)26(23)29/h13,15,19-22,24,28H,3-12,14,16-18H2,1-2H3 |
| InChIKey | CIRQONMMXSJKMM-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.64 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|