C26H34O7S2 — CID 122212944
[(2R,3R,4S)-2-(3,4-dimethoxyphenyl)-4-[2-(3,4,5-trimethoxyphenyl)-1,3-dithian-2-yl]oxolan-3-yl]methanol (PubChem CID 122212944) has the molecular formula C26H34O7S2 and a molecular weight of 522.69 g/mol. Its IUPAC name is [(2R,3R,4S)-2-(3,4-dimethoxyphenyl)-4-[2-(3,4,5-trimethoxyphenyl)-1,3-dithian-2-yl]oxolan-3-yl]methanol.
| Compound Name | [(2R,3R,4S)-2-(3,4-dimethoxyphenyl)-4-[2-(3,4,5-trimethoxyphenyl)-1,3-dithian-2-yl]oxolan-3-yl]methanol |
|---|---|
| PubChem CID | 122212944 |
| Molecular Formula | C26H34O7S2 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | [(2R,3R,4S)-2-(3,4-dimethoxyphenyl)-4-[2-(3,4,5-trimethoxyphenyl)-1,3-dithian-2-yl]oxolan-3-yl]methanol |
| SMILES | COc1ccc([C@@H]2OC[C@@H](C3(c4cc(OC)c(OC)c(OC)c4)SCCCS3)[C@@H]2CO)cc1OC |
| InChI | InChI=1S/C26H34O7S2/c1-28-20-8-7-16(11-21(20)29-2)24-18(14-27)19(15-33-24)26(34-9-6-10-35-26)17-12-22(30-3)25(32-5)23(13-17)31-4/h7-8,11-13,18-19,24,27H,6,9-10,14-15H2,1-5H3/t18-,19+,24-/m0/s1 |
| InChIKey | WJTYHUCXJREQHF-GLDPYIMESA-N |
| XLogP | 4.75 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |