C40H68O4Si2 — CID 10842160
[(1R,2R,3S,4S)-4-[(4-methoxyphenyl)methoxy]-3-methyl-1-phenyl-2-tri(propan-2-yl)silyloxyhept-6-enoxy]-tri(propan-2-yl)silane (PubChem CID 10842160) has the molecular formula C40H68O4Si2 and a molecular weight of 669.15 g/mol. Its IUPAC name is [(1R,2R,3S,4S)-4-[(4-methoxyphenyl)methoxy]-3-methyl-1-phenyl-2-tri(propan-2-yl)silyloxyhept-6-enoxy]-tri(propan-2-yl)silane.
| Compound Name | [(1R,2R,3S,4S)-4-[(4-methoxyphenyl)methoxy]-3-methyl-1-phenyl-2-tri(propan-2-yl)silyloxyhept-6-enoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 10842160 |
| Molecular Formula | C40H68O4Si2 |
| Molecular Weight | 669.15 g/mol |
| Exact Mass | 668.47 |
| IUPAC Name | [(1R,2R,3S,4S)-4-[(4-methoxyphenyl)methoxy]-3-methyl-1-phenyl-2-tri(propan-2-yl)silyloxyhept-6-enoxy]-tri(propan-2-yl)silane |
| SMILES | C=CC[C@H](OCc1ccc(OC)cc1)[C@H](C)[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](O[Si](C(C)C)(C(C)C)C(C)C)c1ccccc1 |
| InChI | InChI=1S/C40H68O4Si2/c1-16-20-38(42-27-35-23-25-37(41-15)26-24-35)34(14)39(43-45(28(2)3,29(4)5)30(6)7)40(36-21-18-17-19-22-36)44-46(31(8)9,32(10)11)33(12)13/h16-19,21-26,28-34,38-40H,1,20,27H2,2-15H3/t34-,38-,39+,40+/m0/s1 |
| InChIKey | IMNPXENHPOGPBR-KZCICRDHSA-N |
| XLogP | 12.29 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.15 |
| LogP ≤ 5 | 12.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|