C22H32O2S2 — CID 11292286
2-[(2E,6E)-8-[(4-methoxyphenyl)methoxy]-6-methylocta-2,6-dien-2-yl]-2-methyl-1,3-dithiane (PubChem CID 11292286) has the molecular formula C22H32O2S2 and a molecular weight of 392.63 g/mol. Its IUPAC name is 2-[(2E,6E)-8-[(4-methoxyphenyl)methoxy]-6-methylocta-2,6-dien-2-yl]-2-methyl-1,3-dithiane.
| Compound Name | 2-[(2E,6E)-8-[(4-methoxyphenyl)methoxy]-6-methylocta-2,6-dien-2-yl]-2-methyl-1,3-dithiane |
|---|---|
| PubChem CID | 11292286 |
| Molecular Formula | C22H32O2S2 |
| Molecular Weight | 392.63 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 2-[(2E,6E)-8-[(4-methoxyphenyl)methoxy]-6-methylocta-2,6-dien-2-yl]-2-methyl-1,3-dithiane |
| SMILES | COc1ccc(COC/C=C(\C)CC/C=C(\C)C2(C)SCCCS2)cc1 |
| InChI | InChI=1S/C22H32O2S2/c1-18(7-5-8-19(2)22(3)25-15-6-16-26-22)13-14-24-17-20-9-11-21(23-4)12-10-20/h8-13H,5-7,14-17H2,1-4H3/b18-13+,19-8+ |
| InChIKey | VDVOARQRALTDOH-SPOMWQMISA-N |
| XLogP | 6.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.63 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|