C22H36O3S2Si — CID 11503094
[(2S,3R,4R)-2-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxy-6,10-dithiaspiro[4.5]decan-4-yl]methanol (PubChem CID 11503094) has the molecular formula C22H36O3S2Si and a molecular weight of 440.75 g/mol. Its IUPAC name is [(2S,3R,4R)-2-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxy-6,10-dithiaspiro[4.5]decan-4-yl]methanol.
| Compound Name | [(2S,3R,4R)-2-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxy-6,10-dithiaspiro[4.5]decan-4-yl]methanol |
|---|---|
| PubChem CID | 11503094 |
| Molecular Formula | C22H36O3S2Si |
| Molecular Weight | 440.75 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | [(2S,3R,4R)-2-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxy-6,10-dithiaspiro[4.5]decan-4-yl]methanol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC2(SCCCS2)[C@H](CO)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C22H36O3S2Si/c1-21(2,3)28(4,5)25-19-14-22(26-12-9-13-27-22)18(15-23)20(19)24-16-17-10-7-6-8-11-17/h6-8,10-11,18-20,23H,9,12-16H2,1-5H3/t18-,19+,20-/m1/s1 |
| InChIKey | JSWQXIKLLSDVHA-HSALFYBXSA-N |
| XLogP | 5.54 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.75 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|