C39H74O3Si2 — CID 23727934
tert-butyl-[(E,2R,10R,14R)-16-[tert-butyl(dimethyl)silyl]oxy-2,6,10,14-tetramethyl-13-phenylmethoxyhexadec-6-enoxy]-dimethylsilane (PubChem CID 23727934) has the molecular formula C39H74O3Si2 and a molecular weight of 647.19 g/mol. Its IUPAC name is tert-butyl-[(E,2R,10R,14R)-16-[tert-butyl(dimethyl)silyl]oxy-2,6,10,14-tetramethyl-13-phenylmethoxyhexadec-6-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E,2R,10R,14R)-16-[tert-butyl(dimethyl)silyl]oxy-2,6,10,14-tetramethyl-13-phenylmethoxyhexadec-6-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 23727934 |
| Molecular Formula | C39H74O3Si2 |
| Molecular Weight | 647.19 g/mol |
| Exact Mass | 646.52 |
| IUPAC Name | tert-butyl-[(E,2R,10R,14R)-16-[tert-butyl(dimethyl)silyl]oxy-2,6,10,14-tetramethyl-13-phenylmethoxyhexadec-6-enoxy]-dimethylsilane |
| SMILES | C/C(=C\CC[C@@H](C)CCC(OCc1ccccc1)[C@H](C)CCO[Si](C)(C)C(C)(C)C)CCC[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C39H74O3Si2/c1-32(21-19-23-34(3)30-42-44(13,14)39(8,9)10)20-18-22-33(2)26-27-37(40-31-36-24-16-15-17-25-36)35(4)28-29-41-43(11,12)38(5,6)7/h15-17,20,24-25,33-35,37H,18-19,21-23,26-31H2,1-14H3/b32-20+/t33-,34-,35-,37?/m1/s1 |
| InChIKey | JFFLCXOEQZKQHL-DWPCSDDRSA-N |
| XLogP | 12.59 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.19 |
| LogP ≤ 5 | 12.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|