C19H30O3Si — CID 10947637
(1R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-(phenylmethoxymethyl)cyclopent-2-en-1-ol (PubChem CID 10947637) has the molecular formula C19H30O3Si and a molecular weight of 334.53 g/mol. Its IUPAC name is (1R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-(phenylmethoxymethyl)cyclopent-2-en-1-ol.
| Compound Name | (1R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-(phenylmethoxymethyl)cyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 10947637 |
| Molecular Formula | C19H30O3Si |
| Molecular Weight | 334.53 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | (1R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-(phenylmethoxymethyl)cyclopent-2-en-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C=C[C@@H](O)[C@@H]1COCc1ccccc1 |
| InChI | InChI=1S/C19H30O3Si/c1-19(2,3)23(4,5)22-18-12-11-17(20)16(18)14-21-13-15-9-7-6-8-10-15/h6-12,16-18,20H,13-14H2,1-5H3/t16-,17+,18-/m0/s1 |
| InChIKey | RKNOMYMTXRFASB-KSZLIROESA-N |
| XLogP | 4.14 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.53 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|