C46H54O3S2Si — CID 11104622
(2R,3R)-3-[2-[(2S)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-1,3-dithian-2-yl]-1-trityloxybutan-2-ol (PubChem CID 11104622) has the molecular formula C46H54O3S2Si and a molecular weight of 747.16 g/mol. Its IUPAC name is (2R,3R)-3-[2-[(2S)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-1,3-dithian-2-yl]-1-trityloxybutan-2-ol.
| Compound Name | (2R,3R)-3-[2-[(2S)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-1,3-dithian-2-yl]-1-trityloxybutan-2-ol |
|---|---|
| PubChem CID | 11104622 |
| Molecular Formula | C46H54O3S2Si |
| Molecular Weight | 747.16 g/mol |
| Exact Mass | 746.33 |
| IUPAC Name | (2R,3R)-3-[2-[(2S)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-1,3-dithian-2-yl]-1-trityloxybutan-2-ol |
| SMILES | C[C@H]([C@@H](O)COC(c1ccccc1)(c1ccccc1)c1ccccc1)C1([C@@H](C)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)SCCCS1 |
| InChI | InChI=1S/C46H54O3S2Si/c1-36(34-49-52(44(3,4)5,41-28-17-9-18-29-41)42-30-19-10-20-31-42)46(50-32-21-33-51-46)37(2)43(47)35-48-45(38-22-11-6-12-23-38,39-24-13-7-14-25-39)40-26-15-8-16-27-40/h6-20,22-31,36-37,43,47H,21,32-35H2,1-5H3/t36-,37+,43-/m0/s1 |
| InChIKey | PTFQRVHHLSWGIG-WVMOZGFBSA-N |
| XLogP | 9.77 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.16 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|