C44H48O4Si — CID 139249882
[(2R,4E,6S)-4-[2-[tert-butyl(diphenyl)silyl]oxyethylidene]-6-(trityloxymethyl)oxan-2-yl]methanol (PubChem CID 139249882) has the molecular formula C44H48O4Si and a molecular weight of 668.95 g/mol. Its IUPAC name is [(2R,4E,6S)-4-[2-[tert-butyl(diphenyl)silyl]oxyethylidene]-6-(trityloxymethyl)oxan-2-yl]methanol.
| Compound Name | [(2R,4E,6S)-4-[2-[tert-butyl(diphenyl)silyl]oxyethylidene]-6-(trityloxymethyl)oxan-2-yl]methanol |
|---|---|
| PubChem CID | 139249882 |
| Molecular Formula | C44H48O4Si |
| Molecular Weight | 668.95 g/mol |
| Exact Mass | 668.33 |
| IUPAC Name | [(2R,4E,6S)-4-[2-[tert-butyl(diphenyl)silyl]oxyethylidene]-6-(trityloxymethyl)oxan-2-yl]methanol |
| SMILES | CC(C)(C)[Si](OC/C=C1/C[C@@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)O[C@@H](CO)C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C44H48O4Si/c1-43(2,3)49(41-25-15-7-16-26-41,42-27-17-8-18-28-42)47-30-29-35-31-39(33-45)48-40(32-35)34-46-44(36-19-9-4-10-20-36,37-21-11-5-12-22-37)38-23-13-6-14-24-38/h4-29,39-40,45H,30-34H2,1-3H3/b35-29+/t39-,40+/m1/s1 |
| InChIKey | OLSLYHRTVBRPMC-UORYXIKXSA-N |
| XLogP | 8.04 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.95 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|