C29H34O2S2 — CID 13129971
(2R,3S,4R)-3-(1,3-dithian-2-yl)-4-methyl-5-trityloxypentan-2-ol (PubChem CID 13129971) has the molecular formula C29H34O2S2 and a molecular weight of 478.72 g/mol. Its IUPAC name is (2R,3S,4R)-3-(1,3-dithian-2-yl)-4-methyl-5-trityloxypentan-2-ol.
| Compound Name | (2R,3S,4R)-3-(1,3-dithian-2-yl)-4-methyl-5-trityloxypentan-2-ol |
|---|---|
| PubChem CID | 13129971 |
| Molecular Formula | C29H34O2S2 |
| Molecular Weight | 478.72 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | (2R,3S,4R)-3-(1,3-dithian-2-yl)-4-methyl-5-trityloxypentan-2-ol |
| SMILES | C[C@@H](O)[C@@H](C1SCCCS1)[C@@H](C)COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H34O2S2/c1-22(27(23(2)30)28-32-19-12-20-33-28)21-31-29(24-13-6-3-7-14-24,25-15-8-4-9-16-25)26-17-10-5-11-18-26/h3-11,13-18,22-23,27-28,30H,12,19-21H2,1-2H3/t22-,23+,27-/m0/s1 |
| InChIKey | PFAVPYJNZFRRFR-OBTVHEKISA-N |
| XLogP | 6.82 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.72 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|