C22H27FO3S2 — CID 54252156
(2S,3R,4S)-4-(1,3-dithian-2-yl)-2-fluoro-3,4-bis(phenylmethoxy)butan-1-ol (PubChem CID 54252156) has the molecular formula C22H27FO3S2 and a molecular weight of 422.59 g/mol. Its IUPAC name is (2S,3R,4S)-4-(1,3-dithian-2-yl)-2-fluoro-3,4-bis(phenylmethoxy)butan-1-ol.
| Compound Name | (2S,3R,4S)-4-(1,3-dithian-2-yl)-2-fluoro-3,4-bis(phenylmethoxy)butan-1-ol |
|---|---|
| PubChem CID | 54252156 |
| Molecular Formula | C22H27FO3S2 |
| Molecular Weight | 422.59 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | (2S,3R,4S)-4-(1,3-dithian-2-yl)-2-fluoro-3,4-bis(phenylmethoxy)butan-1-ol |
| SMILES | OC[C@H](F)[C@H](OCc1ccccc1)[C@H](OCc1ccccc1)C1SCCCS1 |
| InChI | InChI=1S/C22H27FO3S2/c23-19(14-24)20(25-15-17-8-3-1-4-9-17)21(22-27-12-7-13-28-22)26-16-18-10-5-2-6-11-18/h1-6,8-11,19-22,24H,7,12-16H2/t19-,20-,21-/m0/s1 |
| InChIKey | QXNDFGLBILSDPX-ACRUOGEOSA-N |
| XLogP | 4.68 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.59 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |