C23H36OS4Si — CID 134949001
(E)-1-(2-benzyl-1,3-dithian-2-yl)-5-(2-trimethylsilyl-1,3-dithian-2-yl)pent-3-en-2-ol (PubChem CID 134949001) has the molecular formula C23H36OS4Si and a molecular weight of 484.89 g/mol. Its IUPAC name is (E)-1-(2-benzyl-1,3-dithian-2-yl)-5-(2-trimethylsilyl-1,3-dithian-2-yl)pent-3-en-2-ol.
| Compound Name | (E)-1-(2-benzyl-1,3-dithian-2-yl)-5-(2-trimethylsilyl-1,3-dithian-2-yl)pent-3-en-2-ol |
|---|---|
| PubChem CID | 134949001 |
| Molecular Formula | C23H36OS4Si |
| Molecular Weight | 484.89 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | (E)-1-(2-benzyl-1,3-dithian-2-yl)-5-(2-trimethylsilyl-1,3-dithian-2-yl)pent-3-en-2-ol |
| SMILES | C[Si](C)(C)C1(C/C=C/C(O)CC2(Cc3ccccc3)SCCCS2)SCCCS1 |
| InChI | InChI=1S/C23H36OS4Si/c1-29(2,3)23(27-16-9-17-28-23)13-7-12-21(24)19-22(25-14-8-15-26-22)18-20-10-5-4-6-11-20/h4-7,10-12,21,24H,8-9,13-19H2,1-3H3/b12-7+ |
| InChIKey | RTPOZXCRDGZJAP-KPKJPENVSA-N |
| XLogP | 6.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.89 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|