C14H20OS2 — CID 11054688
1-(2-methyl-1,3-dithian-2-yl)-3-phenylpropan-1-ol (PubChem CID 11054688) has the molecular formula C14H20OS2 and a molecular weight of 268.45 g/mol. Its IUPAC name is 1-(2-methyl-1,3-dithian-2-yl)-3-phenylpropan-1-ol.
| Compound Name | 1-(2-methyl-1,3-dithian-2-yl)-3-phenylpropan-1-ol |
|---|---|
| PubChem CID | 11054688 |
| Molecular Formula | C14H20OS2 |
| Molecular Weight | 268.45 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 1-(2-methyl-1,3-dithian-2-yl)-3-phenylpropan-1-ol |
| SMILES | CC1(C(O)CCc2ccccc2)SCCCS1 |
| InChI | InChI=1S/C14H20OS2/c1-14(16-10-5-11-17-14)13(15)9-8-12-6-3-2-4-7-12/h2-4,6-7,13,15H,5,8-11H2,1H3 |
| InChIKey | CIVXKPKXAYUCOW-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |