C14H18OS2 — CID 10378267
(2R)-2-benzyl-3-(1,3-dithian-2-ylidene)propan-1-ol (PubChem CID 10378267) has the molecular formula C14H18OS2 and a molecular weight of 266.43 g/mol. Its IUPAC name is (2R)-2-benzyl-3-(1,3-dithian-2-ylidene)propan-1-ol.
| Compound Name | (2R)-2-benzyl-3-(1,3-dithian-2-ylidene)propan-1-ol |
|---|---|
| PubChem CID | 10378267 |
| Molecular Formula | C14H18OS2 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | (2R)-2-benzyl-3-(1,3-dithian-2-ylidene)propan-1-ol |
| SMILES | OC[C@@H](C=C1SCCCS1)Cc1ccccc1 |
| InChI | InChI=1S/C14H18OS2/c15-11-13(9-12-5-2-1-3-6-12)10-14-16-7-4-8-17-14/h1-3,5-6,10,13,15H,4,7-9,11H2/t13-/m1/s1 |
| InChIKey | HQCYGOOIRBGDSF-CYBMUJFWSA-N |
| XLogP | 3.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |