C13H16O — CID 132552069
3-benzylhexa-4,5-dien-1-ol (PubChem CID 132552069) has the molecular formula C13H16O and a molecular weight of 188.27 g/mol. Its IUPAC name is 3-benzylhexa-4,5-dien-1-ol.
| Compound Name | 3-benzylhexa-4,5-dien-1-ol |
|---|---|
| PubChem CID | 132552069 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 3-benzylhexa-4,5-dien-1-ol |
| SMILES | C=C=CC(CCO)Cc1ccccc1 |
| InChI | InChI=1S/C13H16O/c1-2-6-12(9-10-14)11-13-7-4-3-5-8-13/h3-8,12,14H,1,9-11H2 |
| InChIKey | JPOLKYFEDBGHJK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |