C12H14O2S — CID 101143112
3-(benzenesulfinyl)hexa-4,5-dien-1-ol (PubChem CID 101143112) has the molecular formula C12H14O2S and a molecular weight of 222.31 g/mol. Its IUPAC name is 3-(benzenesulfinyl)hexa-4,5-dien-1-ol.
| Compound Name | 3-(benzenesulfinyl)hexa-4,5-dien-1-ol |
|---|---|
| PubChem CID | 101143112 |
| Molecular Formula | C12H14O2S |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 3-(benzenesulfinyl)hexa-4,5-dien-1-ol |
| SMILES | C=C=CC(CCO)S(=O)c1ccccc1 |
| InChI | InChI=1S/C12H14O2S/c1-2-6-11(9-10-13)15(14)12-7-4-3-5-8-12/h3-8,11,13H,1,9-10H2 |
| InChIKey | YNFRXLUEIZRZSL-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |