C13H16O2S — CID 101097126
5-(benzenesulfinyl)hepta-5,6-dien-1-ol (PubChem CID 101097126) has the molecular formula C13H16O2S and a molecular weight of 236.34 g/mol. Its IUPAC name is 5-(benzenesulfinyl)hepta-5,6-dien-1-ol.
| Compound Name | 5-(benzenesulfinyl)hepta-5,6-dien-1-ol |
|---|---|
| PubChem CID | 101097126 |
| Molecular Formula | C13H16O2S |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 5-(benzenesulfinyl)hepta-5,6-dien-1-ol |
| SMILES | C=C=C(CCCCO)S(=O)c1ccccc1 |
| InChI | InChI=1S/C13H16O2S/c1-2-12(8-6-7-11-14)16(15)13-9-4-3-5-10-13/h3-5,9-10,14H,1,6-8,11H2 |
| InChIKey | NKHYZKSEOTVCAE-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|