C18H18O3S — CID 11012476
3-(benzenesulfinyl)-5-(2-methoxyphenyl)penta-3,4-dien-1-ol (PubChem CID 11012476) has the molecular formula C18H18O3S and a molecular weight of 314.41 g/mol. Its IUPAC name is 3-(benzenesulfinyl)-5-(2-methoxyphenyl)penta-3,4-dien-1-ol.
| Compound Name | 3-(benzenesulfinyl)-5-(2-methoxyphenyl)penta-3,4-dien-1-ol |
|---|---|
| PubChem CID | 11012476 |
| Molecular Formula | C18H18O3S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 3-(benzenesulfinyl)-5-(2-methoxyphenyl)penta-3,4-dien-1-ol |
| SMILES | COc1ccccc1C=C=C(CCO)S(=O)c1ccccc1 |
| InChI | InChI=1S/C18H18O3S/c1-21-18-10-6-5-7-15(18)11-12-17(13-14-19)22(20)16-8-3-2-4-9-16/h2-11,19H,13-14H2,1H3 |
| InChIKey | SXXWQKNOOHIJLU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |