C20H18O4 — CID 87977206
(2E,3E)-2,3-bis[(2-methoxyphenyl)methylidene]butanedial (PubChem CID 87977206) has the molecular formula C20H18O4 and a molecular weight of 322.36 g/mol. Its IUPAC name is (2E,3E)-2,3-bis[(2-methoxyphenyl)methylidene]butanedial.
| Compound Name | (2E,3E)-2,3-bis[(2-methoxyphenyl)methylidene]butanedial |
|---|---|
| PubChem CID | 87977206 |
| Molecular Formula | C20H18O4 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | (2E,3E)-2,3-bis[(2-methoxyphenyl)methylidene]butanedial |
| SMILES | COc1ccccc1/C=C(C=O)\C(C=O)=C/c1ccccc1OC |
| InChI | InChI=1S/C20H18O4/c1-23-19-9-5-3-7-15(19)11-17(13-21)18(14-22)12-16-8-4-6-10-20(16)24-2/h3-14H,1-2H3/b17-11-,18-12- |
| InChIKey | KJMYXRVGQHIKCS-WHYMJUELSA-N |
| XLogP | 3.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|