C20H16N2O2 — CID 86626449
1-[(1E,3E)-2,3-diisocyano-4-(2-methoxyphenyl)buta-1,3-dienyl]-2-methoxybenzene (PubChem CID 86626449) has the molecular formula C20H16N2O2 and a molecular weight of 316.36 g/mol. Its IUPAC name is 1-[(1E,3E)-2,3-diisocyano-4-(2-methoxyphenyl)buta-1,3-dienyl]-2-methoxybenzene.
| Compound Name | 1-[(1E,3E)-2,3-diisocyano-4-(2-methoxyphenyl)buta-1,3-dienyl]-2-methoxybenzene |
|---|---|
| PubChem CID | 86626449 |
| Molecular Formula | C20H16N2O2 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 1-[(1E,3E)-2,3-diisocyano-4-(2-methoxyphenyl)buta-1,3-dienyl]-2-methoxybenzene |
| SMILES | [C-]#[N+]C(=C/c1ccccc1OC)/C(=C\c1ccccc1OC)[N+]#[C-] |
| InChI | InChI=1S/C20H16N2O2/c1-21-17(13-15-9-5-7-11-19(15)23-3)18(22-2)14-16-10-6-8-12-20(16)24-4/h5-14H,3-4H3/b17-13+,18-14+ |
| InChIKey | KSPOOJWDJPTCNV-HBKJEHTGSA-N |
| XLogP | 4.92 |
| TPSA | 27.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|