C18H19O2P — CID 101143116
3-diphenylphosphorylhexa-4,5-dien-1-ol (PubChem CID 101143116) has the molecular formula C18H19O2P and a molecular weight of 298.32 g/mol. Its IUPAC name is 3-diphenylphosphorylhexa-4,5-dien-1-ol.
| Compound Name | 3-diphenylphosphorylhexa-4,5-dien-1-ol |
|---|---|
| PubChem CID | 101143116 |
| Molecular Formula | C18H19O2P |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 3-diphenylphosphorylhexa-4,5-dien-1-ol |
| SMILES | C=C=CC(CCO)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H19O2P/c1-2-9-16(14-15-19)21(20,17-10-5-3-6-11-17)18-12-7-4-8-13-18/h3-13,16,19H,1,14-15H2 |
| InChIKey | MKAVKMUYHUDNOF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|