C11H15NO3 — CID 142645077
[(2R)-4-hydroxy-1-phenylbutan-2-yl]carbamic acid (PubChem CID 142645077) has the molecular formula C11H15NO3 and a molecular weight of 209.25 g/mol. Its IUPAC name is [(2R)-4-hydroxy-1-phenylbutan-2-yl]carbamic acid.
| Compound Name | [(2R)-4-hydroxy-1-phenylbutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 142645077 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | [(2R)-4-hydroxy-1-phenylbutan-2-yl]carbamic acid |
| SMILES | O=C(O)N[C@@H](CCO)Cc1ccccc1 |
| InChI | InChI=1S/C11H15NO3/c13-7-6-10(12-11(14)15)8-9-4-2-1-3-5-9/h1-5,10,12-13H,6-8H2,(H,14,15)/t10-/m0/s1 |
| InChIKey | QAMGJKMKNKLIRH-JTQLQIEISA-N |
| XLogP | 1.25 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |