C14H23NO4S — CID 87150595
4-[(4-hydroxy-1-phenylbutan-2-yl)amino]butane-1-sulfonic acid (PubChem CID 87150595) has the molecular formula C14H23NO4S and a molecular weight of 301.41 g/mol. Its IUPAC name is 4-[(4-hydroxy-1-phenylbutan-2-yl)amino]butane-1-sulfonic acid.
| Compound Name | 4-[(4-hydroxy-1-phenylbutan-2-yl)amino]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 87150595 |
| Molecular Formula | C14H23NO4S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 4-[(4-hydroxy-1-phenylbutan-2-yl)amino]butane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCCNC(CCO)Cc1ccccc1 |
| InChI | InChI=1S/C14H23NO4S/c16-10-8-14(12-13-6-2-1-3-7-13)15-9-4-5-11-20(17,18)19/h1-3,6-7,14-16H,4-5,8-12H2,(H,17,18,19) |
| InChIKey | PINLZNXMWYDFMR-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|