C15H25NO4S — CID 142978331
ethane;3-[[(2S)-3-hydroxy-1-phenylbut-3-en-2-yl]amino]propane-1-sulfonic acid (PubChem CID 142978331) has the molecular formula C15H25NO4S and a molecular weight of 315.44 g/mol. Its IUPAC name is ethane;3-[[(2S)-3-hydroxy-1-phenylbut-3-en-2-yl]amino]propane-1-sulfonic acid.
| Compound Name | ethane;3-[[(2S)-3-hydroxy-1-phenylbut-3-en-2-yl]amino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 142978331 |
| Molecular Formula | C15H25NO4S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | ethane;3-[[(2S)-3-hydroxy-1-phenylbut-3-en-2-yl]amino]propane-1-sulfonic acid |
| SMILES | C=C(O)[C@H](Cc1ccccc1)NCCCS(=O)(=O)O.CC |
| InChI | InChI=1S/C13H19NO4S.C2H6/c1-11(15)13(10-12-6-3-2-4-7-12)14-8-5-9-19(16,17)18;1-2/h2-4,6-7,13-15H,1,5,8-10H2,(H,16,17,18);1-2H3/t13-;/m0./s1 |
| InChIKey | RLJOAUGDIXUXIV-ZOWNYOTGSA-N |
| XLogP | 2.56 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|