About bis(5-benzyl-6-phenylhex-3-en-2-one);palladium(2+)
bis(5-benzyl-6-phenylhex-3-en-2-one);palladium(2+) (PubChem CID 175418386) has the molecular formula C38H38O2Pd
and a molecular weight of 633.14 g/mol. Its IUPAC name is bis(5-benzyl-6-phenylhex-3-en-2-one);palladium(2+).
Molecular Properties
| Compound Name | bis(5-benzyl-6-phenylhex-3-en-2-one);palladium(2+) |
| PubChem CID | 175418386 |
| Molecular Formula | C38H38O2Pd |
| Molecular Weight | 633.14 g/mol |
| Exact Mass | 632.19 |
| IUPAC Name | bis(5-benzyl-6-phenylhex-3-en-2-one);palladium(2+) |
| SMILES | CC(=O)/[C-]=C\C(Cc1ccccc1)Cc1ccccc1.CC(=O)/[C-]=C\C(Cc1ccccc1)Cc1ccccc1.[Pd+2] |
| InChI | InChI=1S/2C19H19O.Pd/c2*1-16(20)12-13-19(14-17-8-4-2-5-9-17)15-18-10-6-3-7-11-18;/h2*2-11,13,19H,14-15H2,1H3;/q2*-1;+2 |
| InChIKey | JBSATLCADIAYKM-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 633.14 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis(5-benzyl-6-phenylhex-3-en-2-one);palladium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(5-benzyl-6-phenylhex-3-en-2-one);palladium(2+)?
The IUPAC name of bis(5-benzyl-6-phenylhex-3-en-2-one);palladium(2+) (CID 175418386) is bis(5-benzyl-6-phenylhex-3-en-2-one);palladium(2+).
What is the SMILES notation for bis(5-benzyl-6-phenylhex-3-en-2-one);palladium(2+)?
The canonical SMILES for bis(5-benzyl-6-phenylhex-3-en-2-one);palladium(2+) is CC(=O)/[C-]=C\C(Cc1ccccc1)Cc1ccccc1.CC(=O)/[C-]=C\C(Cc1ccccc1)Cc1ccccc1.[Pd+2].
What is the InChIKey of bis(5-benzyl-6-phenylhex-3-en-2-one);palladium(2+)?
The InChIKey is JBSATLCADIAYKM-UHFFFAOYSA-N. The full InChI is InChI=1S/2C19H19O.Pd/c2*1-16(20)12-13-19(14-17-8-4-2-5-9-17)15-18-10-6-3-7-11-18;/h2*2-11,13,19H,14-15H2,1H3;/q2*-1;+2.
What are the key properties of bis(5-benzyl-6-phenylhex-3-en-2-one);palladium(2+)?
bis(5-benzyl-6-phenylhex-3-en-2-one);palladium(2+) has a molecular weight of 633.14 g/mol, XLogP of 8.07, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(5-benzyl-6-phenylhex-3-en-2-one);palladium(2+) is sourced from PubChem (CID 175418386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).