C12H14S3 — CID 12516771
2-(2-phenylsulfanylethylidene)-1,3-dithiane (PubChem CID 12516771) has the molecular formula C12H14S3 and a molecular weight of 254.44 g/mol. Its IUPAC name is 2-(2-phenylsulfanylethylidene)-1,3-dithiane.
| Compound Name | 2-(2-phenylsulfanylethylidene)-1,3-dithiane |
|---|---|
| PubChem CID | 12516771 |
| Molecular Formula | C12H14S3 |
| Molecular Weight | 254.44 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 2-(2-phenylsulfanylethylidene)-1,3-dithiane |
| SMILES | C(CSc1ccccc1)=C1SCCCS1 |
| InChI | InChI=1S/C12H14S3/c1-2-5-11(6-3-1)13-10-7-12-14-8-4-9-15-12/h1-3,5-7H,4,8-10H2 |
| InChIKey | IIWFRNDPISAPHV-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.44 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |