About phenylsulfanylbenzene;thiane
phenylsulfanylbenzene;thiane (PubChem CID 67766829) has the molecular formula C17H20S2
and a molecular weight of 288.48 g/mol. Its IUPAC name is phenylsulfanylbenzene;thiane.
Molecular Properties
| Compound Name | phenylsulfanylbenzene;thiane |
| PubChem CID | 67766829 |
| Molecular Formula | C17H20S2 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | phenylsulfanylbenzene;thiane |
| SMILES | C1CCSCC1.c1ccc(Sc2ccccc2)cc1 |
| InChI | InChI=1S/C12H10S.C5H10S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-4-6-5-3-1/h1-10H;1-5H2 |
| InChIKey | IYXNRBINRKESKE-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze phenylsulfanylbenzene;thiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylsulfanylbenzene;thiane?
The IUPAC name of phenylsulfanylbenzene;thiane (CID 67766829) is phenylsulfanylbenzene;thiane.
What is the SMILES notation for phenylsulfanylbenzene;thiane?
The canonical SMILES for phenylsulfanylbenzene;thiane is C1CCSCC1.c1ccc(Sc2ccccc2)cc1.
What is the InChIKey of phenylsulfanylbenzene;thiane?
The InChIKey is IYXNRBINRKESKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10S.C5H10S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-4-6-5-3-1/h1-10H;1-5H2.
What are the key properties of phenylsulfanylbenzene;thiane?
phenylsulfanylbenzene;thiane has a molecular weight of 288.48 g/mol, XLogP of 5.74, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenylsulfanylbenzene;thiane is sourced from PubChem (CID 67766829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).