About [(Z)-2,3-dichloroprop-2-enyl]sulfanylbenzene
[(Z)-2,3-dichloroprop-2-enyl]sulfanylbenzene (PubChem CID 6376519) has the molecular formula C9H8Cl2S
and a molecular weight of 219.14 g/mol. Its IUPAC name is [(Z)-2,3-dichloroprop-2-enyl]sulfanylbenzene.
Molecular Properties
| Compound Name | [(Z)-2,3-dichloroprop-2-enyl]sulfanylbenzene |
| PubChem CID | 6376519 |
| Molecular Formula | C9H8Cl2S |
| Molecular Weight | 219.14 g/mol |
| Exact Mass | 217.97 |
| IUPAC Name | [(Z)-2,3-dichloroprop-2-enyl]sulfanylbenzene |
| SMILES | Cl/C=C(\Cl)CSc1ccccc1 |
| InChI | InChI=1S/C9H8Cl2S/c10-6-8(11)7-12-9-4-2-1-3-5-9/h1-6H,7H2/b8-6- |
| InChIKey | RVUOHKSINRNDNY-VURMDHGXSA-N |
| XLogP | 4.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.14 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [(Z)-2,3-dichloroprop-2-enyl]sulfanylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-2,3-dichloroprop-2-enyl]sulfanylbenzene?
The IUPAC name of [(Z)-2,3-dichloroprop-2-enyl]sulfanylbenzene (CID 6376519) is [(Z)-2,3-dichloroprop-2-enyl]sulfanylbenzene.
What is the SMILES notation for [(Z)-2,3-dichloroprop-2-enyl]sulfanylbenzene?
The canonical SMILES for [(Z)-2,3-dichloroprop-2-enyl]sulfanylbenzene is Cl/C=C(\Cl)CSc1ccccc1.
What is the InChIKey of [(Z)-2,3-dichloroprop-2-enyl]sulfanylbenzene?
The InChIKey is RVUOHKSINRNDNY-VURMDHGXSA-N. The full InChI is InChI=1S/C9H8Cl2S/c10-6-8(11)7-12-9-4-2-1-3-5-9/h1-6H,7H2/b8-6-.
What are the key properties of [(Z)-2,3-dichloroprop-2-enyl]sulfanylbenzene?
[(Z)-2,3-dichloroprop-2-enyl]sulfanylbenzene has a molecular weight of 219.14 g/mol, XLogP of 4.10, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-2,3-dichloroprop-2-enyl]sulfanylbenzene is sourced from PubChem (CID 6376519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).