About CID 50933104
CID 50933104 (PubChem CID 50933104) has the molecular formula C16H20O4PbS2+4
and a molecular weight of 547.67 g/mol.
Molecular Properties
| Compound Name | CID 50933104 |
| PubChem CID | 50933104 |
| Molecular Formula | C16H20O4PbS2+4 |
| Molecular Weight | 547.67 g/mol |
| Exact Mass | 548.05 |
| IUPAC Name | — |
| SMILES | [H]/[O+]=C(\[OH2+])CSc1ccccc1.[H]/[O+]=C(\[OH2+])CSc1ccccc1.[Pb] |
| InChI | InChI=1S/2C8H8O2S.Pb/c2*9-8(10)6-11-7-4-2-1-3-5-7;/h2*1-5H,6H2,(H,9,10);/p+4 |
| InChIKey | WJWWKLUARFSUFI-UHFFFAOYSA-R |
| XLogP | 1.63 |
| TPSA | 88.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 547.67 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze CID 50933104 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 50933104?
The IUPAC name of CID 50933104 (CID 50933104) is not available.
What is the SMILES notation for CID 50933104?
The canonical SMILES for CID 50933104 is [H]/[O+]=C(\[OH2+])CSc1ccccc1.[H]/[O+]=C(\[OH2+])CSc1ccccc1.[Pb].
What is the InChIKey of CID 50933104?
The InChIKey is WJWWKLUARFSUFI-UHFFFAOYSA-R. The full InChI is InChI=1S/2C8H8O2S.Pb/c2*9-8(10)6-11-7-4-2-1-3-5-7;/h2*1-5H,6H2,(H,9,10);/p+4.
What are the key properties of CID 50933104?
CID 50933104 has a molecular weight of 547.67 g/mol, XLogP of 1.63, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 50933104 is sourced from PubChem (CID 50933104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).