C16H14O2S — CID 14288880
1-phenyl-4-phenylsulfanylbutane-1,3-dione (PubChem CID 14288880) has the molecular formula C16H14O2S and a molecular weight of 270.35 g/mol. Its IUPAC name is 1-phenyl-4-phenylsulfanylbutane-1,3-dione.
| Compound Name | 1-phenyl-4-phenylsulfanylbutane-1,3-dione |
|---|---|
| PubChem CID | 14288880 |
| Molecular Formula | C16H14O2S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 1-phenyl-4-phenylsulfanylbutane-1,3-dione |
| SMILES | O=C(CSc1ccccc1)CC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H14O2S/c17-14(12-19-15-9-5-2-6-10-15)11-16(18)13-7-3-1-4-8-13/h1-10H,11-12H2 |
| InChIKey | CBPDOCHVTVOUBE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|