C13H14O4S — CID 57122360
3-(2,4-dioxo-4-phenylbutyl)sulfanylpropanoic acid (PubChem CID 57122360) has the molecular formula C13H14O4S and a molecular weight of 266.32 g/mol. Its IUPAC name is 3-(2,4-dioxo-4-phenylbutyl)sulfanylpropanoic acid.
| Compound Name | 3-(2,4-dioxo-4-phenylbutyl)sulfanylpropanoic acid |
|---|---|
| PubChem CID | 57122360 |
| Molecular Formula | C13H14O4S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 3-(2,4-dioxo-4-phenylbutyl)sulfanylpropanoic acid |
| SMILES | O=C(O)CCSCC(=O)CC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H14O4S/c14-11(9-18-7-6-13(16)17)8-12(15)10-4-2-1-3-5-10/h1-5H,6-9H2,(H,16,17) |
| InChIKey | VAOJTBJSVJYRMR-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|