3-(2,4-dioxo-4-phenylbutyl)sulfanylpropanoic acid

C13H14O4S — CID 57122360

IUPAC3-(2,4-dioxo-4-phenylbutyl)sulfanylpropanoic acid
SMILESO=C(O)CCSCC(=O)CC(=O)c1ccccc1
InChIInChI=1S/C13H14O4S/c14-11(9-18-7-6-13(16)17)8-12(15)10-4-2-1-3-5-10/h1-5H,6-9H2,(H,16,17)
InChIKeyVAOJTBJSVJYRMR-UHFFFAOYSA-N
MW266.32 g/mol
LogP2.04
Rot. Bonds8

About 3-(2,4-dioxo-4-phenylbutyl)sulfanylpropanoic acid

3-(2,4-dioxo-4-phenylbutyl)sulfanylpropanoic acid (PubChem CID 57122360) has the molecular formula C13H14O4S and a molecular weight of 266.32 g/mol. Its IUPAC name is 3-(2,4-dioxo-4-phenylbutyl)sulfanylpropanoic acid.

Molecular Properties

Compound Name3-(2,4-dioxo-4-phenylbutyl)sulfanylpropanoic acid
PubChem CID57122360
Molecular FormulaC13H14O4S
Molecular Weight266.32 g/mol
Exact Mass266.06
IUPAC Name3-(2,4-dioxo-4-phenylbutyl)sulfanylpropanoic acid
SMILESO=C(O)CCSCC(=O)CC(=O)c1ccccc1
InChIInChI=1S/C13H14O4S/c14-11(9-18-7-6-13(16)17)8-12(15)10-4-2-1-3-5-10/h1-5H,6-9H2,(H,16,17)
InChIKeyVAOJTBJSVJYRMR-UHFFFAOYSA-N
XLogP2.04
TPSA71.44 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.32
LogP ≤ 52.04
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 3-(2,4-dioxo-4-phenylbutyl)sulfanylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,4-dioxo-4-phenylbutyl)sulfanylpropanoic acid?
The IUPAC name of 3-(2,4-dioxo-4-phenylbutyl)sulfanylpropanoic acid (CID 57122360) is 3-(2,4-dioxo-4-phenylbutyl)sulfanylpropanoic acid.
What is the SMILES notation for 3-(2,4-dioxo-4-phenylbutyl)sulfanylpropanoic acid?
The canonical SMILES for 3-(2,4-dioxo-4-phenylbutyl)sulfanylpropanoic acid is O=C(O)CCSCC(=O)CC(=O)c1ccccc1.
What is the InChIKey of 3-(2,4-dioxo-4-phenylbutyl)sulfanylpropanoic acid?
The InChIKey is VAOJTBJSVJYRMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O4S/c14-11(9-18-7-6-13(16)17)8-12(15)10-4-2-1-3-5-10/h1-5H,6-9H2,(H,16,17).
What are the key properties of 3-(2,4-dioxo-4-phenylbutyl)sulfanylpropanoic acid?
3-(2,4-dioxo-4-phenylbutyl)sulfanylpropanoic acid has a molecular weight of 266.32 g/mol, XLogP of 2.04, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-dioxo-4-phenylbutyl)sulfanylpropanoic acid is sourced from PubChem (CID 57122360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).