C21H20O4S2 — CID 20510696
4-[(2,4-dioxo-4-phenylbutyl)sulfanylmethylsulfanyl]-1-phenylbutane-1,3-dione (PubChem CID 20510696) has the molecular formula C21H20O4S2 and a molecular weight of 400.52 g/mol. Its IUPAC name is 4-[(2,4-dioxo-4-phenylbutyl)sulfanylmethylsulfanyl]-1-phenylbutane-1,3-dione.
| Compound Name | 4-[(2,4-dioxo-4-phenylbutyl)sulfanylmethylsulfanyl]-1-phenylbutane-1,3-dione |
|---|---|
| PubChem CID | 20510696 |
| Molecular Formula | C21H20O4S2 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | 4-[(2,4-dioxo-4-phenylbutyl)sulfanylmethylsulfanyl]-1-phenylbutane-1,3-dione |
| SMILES | O=C(CSCSCC(=O)CC(=O)c1ccccc1)CC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H20O4S2/c22-18(11-20(24)16-7-3-1-4-8-16)13-26-15-27-14-19(23)12-21(25)17-9-5-2-6-10-17/h1-10H,11-15H2 |
| InChIKey | SVXDTHDHPCWVQA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|