C26H30O8 — CID 101062104
4-[2-[2-[2-(2,4-dioxo-4-phenylbutoxy)ethoxy]ethoxy]ethoxy]-1-phenylbutane-1,3-dione (PubChem CID 101062104) has the molecular formula C26H30O8 and a molecular weight of 470.52 g/mol. Its IUPAC name is 4-[2-[2-[2-(2,4-dioxo-4-phenylbutoxy)ethoxy]ethoxy]ethoxy]-1-phenylbutane-1,3-dione.
| Compound Name | 4-[2-[2-[2-(2,4-dioxo-4-phenylbutoxy)ethoxy]ethoxy]ethoxy]-1-phenylbutane-1,3-dione |
|---|---|
| PubChem CID | 101062104 |
| Molecular Formula | C26H30O8 |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | 4-[2-[2-[2-(2,4-dioxo-4-phenylbutoxy)ethoxy]ethoxy]ethoxy]-1-phenylbutane-1,3-dione |
| SMILES | O=C(COCCOCCOCCOCC(=O)CC(=O)c1ccccc1)CC(=O)c1ccccc1 |
| InChI | InChI=1S/C26H30O8/c27-23(17-25(29)21-7-3-1-4-8-21)19-33-15-13-31-11-12-32-14-16-34-20-24(28)18-26(30)22-9-5-2-6-10-22/h1-10H,11-20H2 |
| InChIKey | HCQSUSVINUFAMK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|