C11H11Cl3S — CID 23264695
[(Z)-3,5,5-trichloropent-2-enyl]sulfanylbenzene (PubChem CID 23264695) has the molecular formula C11H11Cl3S and a molecular weight of 281.63 g/mol. Its IUPAC name is [(Z)-3,5,5-trichloropent-2-enyl]sulfanylbenzene.
| Compound Name | [(Z)-3,5,5-trichloropent-2-enyl]sulfanylbenzene |
|---|---|
| PubChem CID | 23264695 |
| Molecular Formula | C11H11Cl3S |
| Molecular Weight | 281.63 g/mol |
| Exact Mass | 279.96 |
| IUPAC Name | [(Z)-3,5,5-trichloropent-2-enyl]sulfanylbenzene |
| SMILES | Cl/C(=C\CSc1ccccc1)CC(Cl)Cl |
| InChI | InChI=1S/C11H11Cl3S/c12-9(8-11(13)14)6-7-15-10-4-2-1-3-5-10/h1-6,11H,7-8H2/b9-6- |
| InChIKey | OKTZWHGFDSJQNM-TWGQIWQCSA-N |
| XLogP | 5.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.63 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|