C14H18OS2 — CID 10084297
(3R)-3-benzyl-1-oxa-6,10-dithiaspiro[4.5]decane (PubChem CID 10084297) has the molecular formula C14H18OS2 and a molecular weight of 266.43 g/mol. Its IUPAC name is (3R)-3-benzyl-1-oxa-6,10-dithiaspiro[4.5]decane.
| Compound Name | (3R)-3-benzyl-1-oxa-6,10-dithiaspiro[4.5]decane |
|---|---|
| PubChem CID | 10084297 |
| Molecular Formula | C14H18OS2 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | (3R)-3-benzyl-1-oxa-6,10-dithiaspiro[4.5]decane |
| SMILES | c1ccc(C[C@H]2COC3(C2)SCCCS3)cc1 |
| InChI | InChI=1S/C14H18OS2/c1-2-5-12(6-3-1)9-13-10-14(15-11-13)16-7-4-8-17-14/h1-3,5-6,13H,4,7-11H2/t13-/m1/s1 |
| InChIKey | DTFKCVWBIAPHJV-CYBMUJFWSA-N |
| XLogP | 3.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |