C15H17BrS2 — CID 71334195
9-benzyl-7-bromo-1,4-dithiaspiro[4.5]dec-6-ene (PubChem CID 71334195) has the molecular formula C15H17BrS2 and a molecular weight of 341.34 g/mol. Its IUPAC name is 9-benzyl-7-bromo-1,4-dithiaspiro[4.5]dec-6-ene.
| Compound Name | 9-benzyl-7-bromo-1,4-dithiaspiro[4.5]dec-6-ene |
|---|---|
| PubChem CID | 71334195 |
| Molecular Formula | C15H17BrS2 |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | 9-benzyl-7-bromo-1,4-dithiaspiro[4.5]dec-6-ene |
| SMILES | BrC1=CC2(CC(Cc3ccccc3)C1)SCCS2 |
| InChI | InChI=1S/C15H17BrS2/c16-14-9-13(8-12-4-2-1-3-5-12)10-15(11-14)17-6-7-18-15/h1-5,11,13H,6-10H2 |
| InChIKey | CRMJKQGDMFFEOW-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |