About 4-benzylphosphinane
4-benzylphosphinane (PubChem CID 130251660) has the molecular formula C12H17P
and a molecular weight of 192.24 g/mol. Its IUPAC name is 4-benzylphosphinane.
Molecular Properties
| Compound Name | 4-benzylphosphinane |
| PubChem CID | 130251660 |
| Molecular Formula | C12H17P |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | 4-benzylphosphinane |
| SMILES | c1ccc(CC2CCPCC2)cc1 |
| InChI | InChI=1S/C12H17P/c1-2-4-11(5-3-1)10-12-6-8-13-9-7-12/h1-5,12-13H,6-10H2 |
| InChIKey | YENDXEWUFSJLSU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-benzylphosphinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzylphosphinane?
The IUPAC name of 4-benzylphosphinane (CID 130251660) is 4-benzylphosphinane.
What is the SMILES notation for 4-benzylphosphinane?
The canonical SMILES for 4-benzylphosphinane is c1ccc(CC2CCPCC2)cc1.
What is the InChIKey of 4-benzylphosphinane?
The InChIKey is YENDXEWUFSJLSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17P/c1-2-4-11(5-3-1)10-12-6-8-13-9-7-12/h1-5,12-13H,6-10H2.
What are the key properties of 4-benzylphosphinane?
4-benzylphosphinane has a molecular weight of 192.24 g/mol, XLogP of 3.32, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzylphosphinane is sourced from PubChem (CID 130251660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).