C17H24O2S2 — CID 10829854
8-ethyl-10-phenylmethoxy-9-oxa-1,5-dithiaspiro[5.5]undecane (PubChem CID 10829854) has the molecular formula C17H24O2S2 and a molecular weight of 324.51 g/mol. Its IUPAC name is 8-ethyl-10-phenylmethoxy-9-oxa-1,5-dithiaspiro[5.5]undecane.
| Compound Name | 8-ethyl-10-phenylmethoxy-9-oxa-1,5-dithiaspiro[5.5]undecane |
|---|---|
| PubChem CID | 10829854 |
| Molecular Formula | C17H24O2S2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 8-ethyl-10-phenylmethoxy-9-oxa-1,5-dithiaspiro[5.5]undecane |
| SMILES | CCC1CC2(CC(OCc3ccccc3)O1)SCCCS2 |
| InChI | InChI=1S/C17H24O2S2/c1-2-15-11-17(20-9-6-10-21-17)12-16(19-15)18-13-14-7-4-3-5-8-14/h3-5,7-8,15-16H,2,6,9-13H2,1H3 |
| InChIKey | RNZWAMIKBYJLIJ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |