C15H22OS2 — CID 18681978
4-(1,3-dithian-2-yl)-5-phenylpentan-2-ol (PubChem CID 18681978) has the molecular formula C15H22OS2 and a molecular weight of 282.47 g/mol. Its IUPAC name is 4-(1,3-dithian-2-yl)-5-phenylpentan-2-ol.
| Compound Name | 4-(1,3-dithian-2-yl)-5-phenylpentan-2-ol |
|---|---|
| PubChem CID | 18681978 |
| Molecular Formula | C15H22OS2 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 4-(1,3-dithian-2-yl)-5-phenylpentan-2-ol |
| SMILES | CC(O)CC(Cc1ccccc1)C1SCCCS1 |
| InChI | InChI=1S/C15H22OS2/c1-12(16)10-14(15-17-8-5-9-18-15)11-13-6-3-2-4-7-13/h2-4,6-7,12,14-16H,5,8-11H2,1H3 |
| InChIKey | XQEJTKOFUYHOTH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |