C25H40O2S2Si — CID 11677043
(2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-[2-[(E)-2-phenylethenyl]-1,3-dithian-2-yl]hept-6-en-2-ol (PubChem CID 11677043) has the molecular formula C25H40O2S2Si and a molecular weight of 464.81 g/mol. Its IUPAC name is (2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-[2-[(E)-2-phenylethenyl]-1,3-dithian-2-yl]hept-6-en-2-ol.
| Compound Name | (2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-[2-[(E)-2-phenylethenyl]-1,3-dithian-2-yl]hept-6-en-2-ol |
|---|---|
| PubChem CID | 11677043 |
| Molecular Formula | C25H40O2S2Si |
| Molecular Weight | 464.81 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | (2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-[2-[(E)-2-phenylethenyl]-1,3-dithian-2-yl]hept-6-en-2-ol |
| SMILES | C=CC[C@@H](C[C@@H](O)CC1(/C=C/c2ccccc2)SCCCS1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H40O2S2Si/c1-7-12-23(27-30(5,6)24(2,3)4)19-22(26)20-25(28-17-11-18-29-25)16-15-21-13-9-8-10-14-21/h7-10,13-16,22-23,26H,1,11-12,17-20H2,2-6H3/b16-15+/t22-,23+/m1/s1 |
| InChIKey | IERQKZQUJWGQTH-OVRJOZPVSA-N |
| XLogP | 7.37 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.81 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|